C14H11BrCl2N2O2 — CID 156854434
1-[3-bromo-2-(hydroxymethyl)phenyl]-3-(3,5-dichlorophenyl)urea (PubChem CID 156854434) has the molecular formula C14H11BrCl2N2O2 and a molecular weight of 390.06 g/mol. Its IUPAC name is 1-[3-bromo-2-(hydroxymethyl)phenyl]-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-[3-bromo-2-(hydroxymethyl)phenyl]-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 156854434 |
| Molecular Formula | C14H11BrCl2N2O2 |
| Molecular Weight | 390.06 g/mol |
| Exact Mass | 387.94 |
| IUPAC Name | 1-[3-bromo-2-(hydroxymethyl)phenyl]-3-(3,5-dichlorophenyl)urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)Nc1cccc(Br)c1CO |
| InChI | InChI=1S/C14H11BrCl2N2O2/c15-12-2-1-3-13(11(12)7-20)19-14(21)18-10-5-8(16)4-9(17)6-10/h1-6,20H,7H2,(H2,18,19,21) |
| InChIKey | KRNXUQWHWMSIDB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.06 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |