C13H11BrClN3O2 — CID 156854356
1-(2-bromo-4-pyridinyl)-3-[3-chloro-2-(hydroxymethyl)phenyl]urea (PubChem CID 156854356) has the molecular formula C13H11BrClN3O2 and a molecular weight of 356.61 g/mol. Its IUPAC name is 1-(2-bromo-4-pyridinyl)-3-[3-chloro-2-(hydroxymethyl)phenyl]urea.
| Compound Name | 1-(2-bromo-4-pyridinyl)-3-[3-chloro-2-(hydroxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 156854356 |
| Molecular Formula | C13H11BrClN3O2 |
| Molecular Weight | 356.61 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 1-(2-bromo-4-pyridinyl)-3-[3-chloro-2-(hydroxymethyl)phenyl]urea |
| SMILES | O=C(Nc1ccnc(Br)c1)Nc1cccc(Cl)c1CO |
| InChI | InChI=1S/C13H11BrClN3O2/c14-12-6-8(4-5-16-12)17-13(20)18-11-3-1-2-10(15)9(11)7-19/h1-6,19H,7H2,(H2,16,17,18,20) |
| InChIKey | QLZRFGXYCNTMES-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|