C14H15BrFN3O — CID 167683559
1-(2-bromo-4-pyridinyl)-3-(2-fluoro-3-methylphenyl)urea;methane (PubChem CID 167683559) has the molecular formula C14H15BrFN3O and a molecular weight of 340.20 g/mol. Its IUPAC name is 1-(2-bromo-4-pyridinyl)-3-(2-fluoro-3-methylphenyl)urea;methane.
| Compound Name | 1-(2-bromo-4-pyridinyl)-3-(2-fluoro-3-methylphenyl)urea;methane |
|---|---|
| PubChem CID | 167683559 |
| Molecular Formula | C14H15BrFN3O |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 1-(2-bromo-4-pyridinyl)-3-(2-fluoro-3-methylphenyl)urea;methane |
| SMILES | C.Cc1cccc(NC(=O)Nc2ccnc(Br)c2)c1F |
| InChI | InChI=1S/C13H11BrFN3O.CH4/c1-8-3-2-4-10(12(8)15)18-13(19)17-9-5-6-16-11(14)7-9;/h2-7H,1H3,(H2,16,17,18,19);1H4 |
| InChIKey | VWSZAALWNRLFDJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|