C22H22N4O2 — CID 1110848
1-(2-methylphenyl)-3-[3-[(2-methylphenyl)carbamoylamino]phenyl]urea (PubChem CID 1110848) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[3-[(2-methylphenyl)carbamoylamino]phenyl]urea.
| Compound Name | 1-(2-methylphenyl)-3-[3-[(2-methylphenyl)carbamoylamino]phenyl]urea |
|---|---|
| PubChem CID | 1110848 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-(2-methylphenyl)-3-[3-[(2-methylphenyl)carbamoylamino]phenyl]urea |
| SMILES | Cc1ccccc1NC(=O)Nc1cccc(NC(=O)Nc2ccccc2C)c1 |
| InChI | InChI=1S/C22H22N4O2/c1-15-8-3-5-12-19(15)25-21(27)23-17-10-7-11-18(14-17)24-22(28)26-20-13-6-4-9-16(20)2/h3-14H,1-2H3,(H2,23,25,27)(H2,24,26,28) |
| InChIKey | QPRZJIMXMVWCAO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |