C14H14ClN2O+ — CID 148876031
[3-[(2-methylphenyl)carbamoylamino]phenyl]chloranium (PubChem CID 148876031) has the molecular formula C14H14ClN2O+ and a molecular weight of 261.73 g/mol. Its IUPAC name is [3-[(2-methylphenyl)carbamoylamino]phenyl]chloranium.
| Compound Name | [3-[(2-methylphenyl)carbamoylamino]phenyl]chloranium |
|---|---|
| PubChem CID | 148876031 |
| Molecular Formula | C14H14ClN2O+ |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | [3-[(2-methylphenyl)carbamoylamino]phenyl]chloranium |
| SMILES | Cc1ccccc1NC(=O)Nc1cccc([ClH+])c1 |
| InChI | InChI=1S/C14H13ClN2O/c1-10-5-2-3-8-13(10)17-14(18)16-12-7-4-6-11(15)9-12/h2-9,15H,1H3,(H-,16,17,18)/p+1 |
| InChIKey | PCCTZUUUMFZPMZ-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |