C15H13ClF2N2O2 — CID 156854357
1-[3-chloro-2-(2-hydroxyethyl)phenyl]-3-(3,5-difluorophenyl)urea (PubChem CID 156854357) has the molecular formula C15H13ClF2N2O2 and a molecular weight of 326.73 g/mol. Its IUPAC name is 1-[3-chloro-2-(2-hydroxyethyl)phenyl]-3-(3,5-difluorophenyl)urea.
| Compound Name | 1-[3-chloro-2-(2-hydroxyethyl)phenyl]-3-(3,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 156854357 |
| Molecular Formula | C15H13ClF2N2O2 |
| Molecular Weight | 326.73 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 1-[3-chloro-2-(2-hydroxyethyl)phenyl]-3-(3,5-difluorophenyl)urea |
| SMILES | O=C(Nc1cc(F)cc(F)c1)Nc1cccc(Cl)c1CCO |
| InChI | InChI=1S/C15H13ClF2N2O2/c16-13-2-1-3-14(12(13)4-5-21)20-15(22)19-11-7-9(17)6-10(18)8-11/h1-3,6-8,21H,4-5H2,(H2,19,20,22) |
| InChIKey | ANKITFYPOSWXPH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.73 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |