C14H11Br2ClN2O2 — CID 156854573
1-[3-chloro-2-(hydroxymethyl)phenyl]-3-(3,5-dibromophenyl)urea (PubChem CID 156854573) has the molecular formula C14H11Br2ClN2O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is 1-[3-chloro-2-(hydroxymethyl)phenyl]-3-(3,5-dibromophenyl)urea.
| Compound Name | 1-[3-chloro-2-(hydroxymethyl)phenyl]-3-(3,5-dibromophenyl)urea |
|---|---|
| PubChem CID | 156854573 |
| Molecular Formula | C14H11Br2ClN2O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 431.89 |
| IUPAC Name | 1-[3-chloro-2-(hydroxymethyl)phenyl]-3-(3,5-dibromophenyl)urea |
| SMILES | O=C(Nc1cc(Br)cc(Br)c1)Nc1cccc(Cl)c1CO |
| InChI | InChI=1S/C14H11Br2ClN2O2/c15-8-4-9(16)6-10(5-8)18-14(21)19-13-3-1-2-12(17)11(13)7-20/h1-6,20H,7H2,(H2,18,19,21) |
| InChIKey | FZTMPSRSDGKDIU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |