C13H10Br2N2O — CID 25129837
1-(3,5-dibromophenyl)-3-phenylurea (PubChem CID 25129837) has the molecular formula C13H10Br2N2O and a molecular weight of 370.04 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)-3-phenylurea.
| Compound Name | 1-(3,5-dibromophenyl)-3-phenylurea |
|---|---|
| PubChem CID | 25129837 |
| Molecular Formula | C13H10Br2N2O |
| Molecular Weight | 370.04 g/mol |
| Exact Mass | 367.92 |
| IUPAC Name | 1-(3,5-dibromophenyl)-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H10Br2N2O/c14-9-6-10(15)8-12(7-9)17-13(18)16-11-4-2-1-3-5-11/h1-8H,(H2,16,17,18) |
| InChIKey | ATLUFNAETXCIGU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.04 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |