C13H8Br2Cl2N2O — CID 175721758
1-(3,5-dibromophenyl)-3-(3,5-dichlorophenyl)urea (PubChem CID 175721758) has the molecular formula C13H8Br2Cl2N2O and a molecular weight of 438.93 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-(3,5-dibromophenyl)-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 175721758 |
| Molecular Formula | C13H8Br2Cl2N2O |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 435.84 |
| IUPAC Name | 1-(3,5-dibromophenyl)-3-(3,5-dichlorophenyl)urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)Nc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H8Br2Cl2N2O/c14-7-1-8(15)3-11(2-7)18-13(20)19-12-5-9(16)4-10(17)6-12/h1-6H,(H2,18,19,20) |
| InChIKey | XALFRNNCJLMMIH-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |