About 1-cyano-3-(3,5-dichlorophenyl)urea
1-cyano-3-(3,5-dichlorophenyl)urea (PubChem CID 107654843) has the molecular formula C8H5Cl2N3O
and a molecular weight of 230.05 g/mol. Its IUPAC name is 1-cyano-3-(3,5-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-cyano-3-(3,5-dichlorophenyl)urea |
| PubChem CID | 107654843 |
| Molecular Formula | C8H5Cl2N3O |
| Molecular Weight | 230.05 g/mol |
| Exact Mass | 228.98 |
| IUPAC Name | 1-cyano-3-(3,5-dichlorophenyl)urea |
| SMILES | N#CNC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H5Cl2N3O/c9-5-1-6(10)3-7(2-5)13-8(14)12-4-11/h1-3H,(H2,12,13,14) |
| InChIKey | VAAWKUIDFDIMHD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.05 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 1-cyano-3-(3,5-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-3-(3,5-dichlorophenyl)urea?
The IUPAC name of 1-cyano-3-(3,5-dichlorophenyl)urea (CID 107654843) is 1-cyano-3-(3,5-dichlorophenyl)urea.
What is the SMILES notation for 1-cyano-3-(3,5-dichlorophenyl)urea?
The canonical SMILES for 1-cyano-3-(3,5-dichlorophenyl)urea is N#CNC(=O)Nc1cc(Cl)cc(Cl)c1.
What is the InChIKey of 1-cyano-3-(3,5-dichlorophenyl)urea?
The InChIKey is VAAWKUIDFDIMHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2N3O/c9-5-1-6(10)3-7(2-5)13-8(14)12-4-11/h1-3H,(H2,12,13,14).
What are the key properties of 1-cyano-3-(3,5-dichlorophenyl)urea?
1-cyano-3-(3,5-dichlorophenyl)urea has a molecular weight of 230.05 g/mol, XLogP of 2.60, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-3-(3,5-dichlorophenyl)urea is sourced from PubChem (CID 107654843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).