C8H5Cl2N3O — CID 107654843
1-cyano-3-(3,5-dichlorophenyl)urea (PubChem CID 107654843) has the molecular formula C8H5Cl2N3O and a molecular weight of 230.05 g/mol. Its IUPAC name is 1-cyano-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-cyano-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 107654843 |
| Molecular Formula | C8H5Cl2N3O |
| Molecular Weight | 230.05 g/mol |
| Exact Mass | 228.98 |
| IUPAC Name | 1-cyano-3-(3,5-dichlorophenyl)urea |
| SMILES | N#CNC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H5Cl2N3O/c9-5-1-6(10)3-7(2-5)13-8(14)12-4-11/h1-3H,(H2,12,13,14) |
| InChIKey | VAAWKUIDFDIMHD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.05 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|