C14H8Cl3N3O — CID 107653480
1-(2-chloro-5-cyanophenyl)-3-(3,5-dichlorophenyl)urea (PubChem CID 107653480) has the molecular formula C14H8Cl3N3O and a molecular weight of 340.60 g/mol. Its IUPAC name is 1-(2-chloro-5-cyanophenyl)-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-(2-chloro-5-cyanophenyl)-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 107653480 |
| Molecular Formula | C14H8Cl3N3O |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 1-(2-chloro-5-cyanophenyl)-3-(3,5-dichlorophenyl)urea |
| SMILES | N#Cc1ccc(Cl)c(NC(=O)Nc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C14H8Cl3N3O/c15-9-4-10(16)6-11(5-9)19-14(21)20-13-3-8(7-18)1-2-12(13)17/h1-6H,(H2,19,20,21) |
| InChIKey | OSTRYNLYIBMUOR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |