C12H13ClN2OS — CID 107032759
N-(2-chloro-5-cyanophenyl)-3-methyl-2-sulfanylbutanamide (PubChem CID 107032759) has the molecular formula C12H13ClN2OS and a molecular weight of 268.77 g/mol. Its IUPAC name is N-(2-chloro-5-cyanophenyl)-3-methyl-2-sulfanylbutanamide.
| Compound Name | N-(2-chloro-5-cyanophenyl)-3-methyl-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 107032759 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | N-(2-chloro-5-cyanophenyl)-3-methyl-2-sulfanylbutanamide |
| SMILES | CC(C)C(S)C(=O)Nc1cc(C#N)ccc1Cl |
| InChI | InChI=1S/C12H13ClN2OS/c1-7(2)11(17)12(16)15-10-5-8(6-14)3-4-9(10)13/h3-5,7,11,17H,1-2H3,(H,15,16) |
| InChIKey | TYWJSOFXVJXVGS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|