C12H12BrClN2O — CID 55132641
N-(5-bromo-2-chlorophenyl)-2-cyano-3-methylbutanamide (PubChem CID 55132641) has the molecular formula C12H12BrClN2O and a molecular weight of 315.60 g/mol. Its IUPAC name is N-(5-bromo-2-chlorophenyl)-2-cyano-3-methylbutanamide.
| Compound Name | N-(5-bromo-2-chlorophenyl)-2-cyano-3-methylbutanamide |
|---|---|
| PubChem CID | 55132641 |
| Molecular Formula | C12H12BrClN2O |
| Molecular Weight | 315.60 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | N-(5-bromo-2-chlorophenyl)-2-cyano-3-methylbutanamide |
| SMILES | CC(C)C(C#N)C(=O)Nc1cc(Br)ccc1Cl |
| InChI | InChI=1S/C12H12BrClN2O/c1-7(2)9(6-15)12(17)16-11-5-8(13)3-4-10(11)14/h3-5,7,9H,1-2H3,(H,16,17) |
| InChIKey | FSEARCWYBQOVPK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |