C13H14ClN3O3S — CID 104910469
(2R)-2-[(2-chloro-5-cyanophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 104910469) has the molecular formula C13H14ClN3O3S and a molecular weight of 327.79 g/mol. Its IUPAC name is (2R)-2-[(2-chloro-5-cyanophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(2-chloro-5-cyanophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104910469 |
| Molecular Formula | C13H14ClN3O3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | (2R)-2-[(2-chloro-5-cyanophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)Nc1cc(C#N)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C13H14ClN3O3S/c1-21-5-4-10(12(18)19)16-13(20)17-11-6-8(7-15)2-3-9(11)14/h2-3,6,10H,4-5H2,1H3,(H,18,19)(H2,16,17,20)/t10-/m1/s1 |
| InChIKey | NKURGEXOXRGIRN-SNVBAGLBSA-N |
| XLogP | 2.54 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |