C12H14ClIN2O3S — CID 107605894
2-[(2-chloro-4-iodophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 107605894) has the molecular formula C12H14ClIN2O3S and a molecular weight of 428.68 g/mol. Its IUPAC name is 2-[(2-chloro-4-iodophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(2-chloro-4-iodophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 107605894 |
| Molecular Formula | C12H14ClIN2O3S |
| Molecular Weight | 428.68 g/mol |
| Exact Mass | 427.95 |
| IUPAC Name | 2-[(2-chloro-4-iodophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)Nc1ccc(I)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H14ClIN2O3S/c1-20-5-4-10(11(17)18)16-12(19)15-9-3-2-7(14)6-8(9)13/h2-3,6,10H,4-5H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | GGKDURKNOMMTGD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.68 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|