C12H14Br2N2O3S — CID 104910045
(2R)-2-[(2,4-dibromophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 104910045) has the molecular formula C12H14Br2N2O3S and a molecular weight of 426.13 g/mol. Its IUPAC name is (2R)-2-[(2,4-dibromophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(2,4-dibromophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104910045 |
| Molecular Formula | C12H14Br2N2O3S |
| Molecular Weight | 426.13 g/mol |
| Exact Mass | 423.91 |
| IUPAC Name | (2R)-2-[(2,4-dibromophenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)Nc1ccc(Br)cc1Br)C(=O)O |
| InChI | InChI=1S/C12H14Br2N2O3S/c1-20-5-4-10(11(17)18)16-12(19)15-9-3-2-7(13)6-8(9)14/h2-3,6,10H,4-5H2,1H3,(H,17,18)(H2,15,16,19)/t10-/m1/s1 |
| InChIKey | YYDMZJKWLPFEKW-SNVBAGLBSA-N |
| XLogP | 3.54 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.13 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |