C11H10ClIN2O5 — CID 107605873
(2R)-2-[(2-chloro-4-iodophenyl)carbamoylamino]butanedioic acid (PubChem CID 107605873) has the molecular formula C11H10ClIN2O5 and a molecular weight of 412.57 g/mol. Its IUPAC name is (2R)-2-[(2-chloro-4-iodophenyl)carbamoylamino]butanedioic acid.
| Compound Name | (2R)-2-[(2-chloro-4-iodophenyl)carbamoylamino]butanedioic acid |
|---|---|
| PubChem CID | 107605873 |
| Molecular Formula | C11H10ClIN2O5 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 411.93 |
| IUPAC Name | (2R)-2-[(2-chloro-4-iodophenyl)carbamoylamino]butanedioic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)Nc1ccc(I)cc1Cl)C(=O)O |
| InChI | InChI=1S/C11H10ClIN2O5/c12-6-3-5(13)1-2-7(6)14-11(20)15-8(10(18)19)4-9(16)17/h1-3,8H,4H2,(H,16,17)(H,18,19)(H2,14,15,20)/t8-/m1/s1 |
| InChIKey | DKSCBPHCPIFKSH-MRVPVSSYSA-N |
| XLogP | 1.99 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|