C12H11ClN4O4 — CID 107809371
4-amino-2-[(2-chloro-4-cyanophenyl)carbamoylamino]-4-oxobutanoic acid (PubChem CID 107809371) has the molecular formula C12H11ClN4O4 and a molecular weight of 310.70 g/mol. Its IUPAC name is 4-amino-2-[(2-chloro-4-cyanophenyl)carbamoylamino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(2-chloro-4-cyanophenyl)carbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107809371 |
| Molecular Formula | C12H11ClN4O4 |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 4-amino-2-[(2-chloro-4-cyanophenyl)carbamoylamino]-4-oxobutanoic acid |
| SMILES | N#Cc1ccc(NC(=O)NC(CC(N)=O)C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C12H11ClN4O4/c13-7-3-6(5-14)1-2-8(7)16-12(21)17-9(11(19)20)4-10(15)18/h1-3,9H,4H2,(H2,15,18)(H,19,20)(H2,16,17,21) |
| InChIKey | LAJYKLCMIKDNBC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 145.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |