C11H10ClN3O3 — CID 107809286
(2R)-2-[(2-chloro-4-cyanophenyl)carbamoylamino]propanoic acid (PubChem CID 107809286) has the molecular formula C11H10ClN3O3 and a molecular weight of 267.67 g/mol. Its IUPAC name is (2R)-2-[(2-chloro-4-cyanophenyl)carbamoylamino]propanoic acid.
| Compound Name | (2R)-2-[(2-chloro-4-cyanophenyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 107809286 |
| Molecular Formula | C11H10ClN3O3 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | (2R)-2-[(2-chloro-4-cyanophenyl)carbamoylamino]propanoic acid |
| SMILES | C[C@@H](NC(=O)Nc1ccc(C#N)cc1Cl)C(=O)O |
| InChI | InChI=1S/C11H10ClN3O3/c1-6(10(16)17)14-11(18)15-9-3-2-7(5-13)4-8(9)12/h2-4,6H,1H3,(H,16,17)(H2,14,15,18)/t6-/m1/s1 |
| InChIKey | PXGQEZXBIFJJOE-ZCFIWIBFSA-N |
| XLogP | 1.81 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |