C11H11ClN2O2 — CID 102669063
(2S)-2-[(2-chloro-4-cyanophenyl)methylamino]propanoic acid (PubChem CID 102669063) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-4-cyanophenyl)methylamino]propanoic acid.
| Compound Name | (2S)-2-[(2-chloro-4-cyanophenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 102669063 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | (2S)-2-[(2-chloro-4-cyanophenyl)methylamino]propanoic acid |
| SMILES | C[C@H](NCc1ccc(C#N)cc1Cl)C(=O)O |
| InChI | InChI=1S/C11H11ClN2O2/c1-7(11(15)16)14-6-9-3-2-8(5-13)4-10(9)12/h2-4,7,14H,6H2,1H3,(H,15,16)/t7-/m0/s1 |
| InChIKey | CAAPNECEWGUUOS-ZETCQYMHSA-N |
| XLogP | 1.77 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |