C13H17ClN2OS — CID 106160792
3-chloro-4-[[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]methyl]benzonitrile (PubChem CID 106160792) has the molecular formula C13H17ClN2OS and a molecular weight of 284.81 g/mol. Its IUPAC name is 3-chloro-4-[[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]methyl]benzonitrile.
| Compound Name | 3-chloro-4-[[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 106160792 |
| Molecular Formula | C13H17ClN2OS |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-chloro-4-[[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]methyl]benzonitrile |
| SMILES | CSC(CO)C(C)NCc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C13H17ClN2OS/c1-9(13(8-17)18-2)16-7-11-4-3-10(6-15)5-12(11)14/h3-5,9,13,16-17H,7-8H2,1-2H3 |
| InChIKey | QMZGZPWINPZNRH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |