C11H10ClN3O4 — CID 107809378
3-[(2-chloro-4-cyanophenyl)carbamoylamino]-2-hydroxypropanoic acid (PubChem CID 107809378) has the molecular formula C11H10ClN3O4 and a molecular weight of 283.67 g/mol. Its IUPAC name is 3-[(2-chloro-4-cyanophenyl)carbamoylamino]-2-hydroxypropanoic acid.
| Compound Name | 3-[(2-chloro-4-cyanophenyl)carbamoylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 107809378 |
| Molecular Formula | C11H10ClN3O4 |
| Molecular Weight | 283.67 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 3-[(2-chloro-4-cyanophenyl)carbamoylamino]-2-hydroxypropanoic acid |
| SMILES | N#Cc1ccc(NC(=O)NCC(O)C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C11H10ClN3O4/c12-7-3-6(4-13)1-2-8(7)15-11(19)14-5-9(16)10(17)18/h1-3,9,16H,5H2,(H,17,18)(H2,14,15,19) |
| InChIKey | WCYLXTKSUSDGBS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.67 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |