C10H9Cl3N2O4 — CID 66166112
2-hydroxy-3-[(2,4,5-trichlorophenyl)carbamoylamino]propanoic acid (PubChem CID 66166112) has the molecular formula C10H9Cl3N2O4 and a molecular weight of 327.55 g/mol. Its IUPAC name is 2-hydroxy-3-[(2,4,5-trichlorophenyl)carbamoylamino]propanoic acid.
| Compound Name | 2-hydroxy-3-[(2,4,5-trichlorophenyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 66166112 |
| Molecular Formula | C10H9Cl3N2O4 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | 2-hydroxy-3-[(2,4,5-trichlorophenyl)carbamoylamino]propanoic acid |
| SMILES | O=C(NCC(O)C(=O)O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl3N2O4/c11-4-1-6(13)7(2-5(4)12)15-10(19)14-3-8(16)9(17)18/h1-2,8,16H,3H2,(H,17,18)(H2,14,15,19) |
| InChIKey | JLAYVZIKCAOFAF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|