C9H9Cl3N2O2 — CID 119026702
1-(2-hydroxyethyl)-3-(2,4,5-trichlorophenyl)urea (PubChem CID 119026702) has the molecular formula C9H9Cl3N2O2 and a molecular weight of 283.54 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(2,4,5-trichlorophenyl)urea.
| Compound Name | 1-(2-hydroxyethyl)-3-(2,4,5-trichlorophenyl)urea |
|---|---|
| PubChem CID | 119026702 |
| Molecular Formula | C9H9Cl3N2O2 |
| Molecular Weight | 283.54 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(2,4,5-trichlorophenyl)urea |
| SMILES | O=C(NCCO)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl3N2O2/c10-5-3-7(12)8(4-6(5)11)14-9(16)13-1-2-15/h3-4,15H,1-2H2,(H2,13,14,16) |
| InChIKey | RKIHFYHNAKMAEB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.54 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|