C9H6Cl4N2O2 — CID 43146050
2-chloro-N-[(2,4,5-trichlorophenyl)carbamoyl]acetamide (PubChem CID 43146050) has the molecular formula C9H6Cl4N2O2 and a molecular weight of 315.97 g/mol. Its IUPAC name is 2-chloro-N-[(2,4,5-trichlorophenyl)carbamoyl]acetamide.
| Compound Name | 2-chloro-N-[(2,4,5-trichlorophenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 43146050 |
| Molecular Formula | C9H6Cl4N2O2 |
| Molecular Weight | 315.97 g/mol |
| Exact Mass | 313.92 |
| IUPAC Name | 2-chloro-N-[(2,4,5-trichlorophenyl)carbamoyl]acetamide |
| SMILES | O=C(CCl)NC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H6Cl4N2O2/c10-3-8(16)15-9(17)14-7-2-5(12)4(11)1-6(7)13/h1-2H,3H2,(H2,14,15,16,17) |
| InChIKey | QZNDFHWDCUPGKH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.97 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|