C7H3Cl3FNO — CID 88834556
N-(2,4,5-trichlorophenyl)carbamoyl fluoride (PubChem CID 88834556) has the molecular formula C7H3Cl3FNO and a molecular weight of 242.46 g/mol. Its IUPAC name is N-(2,4,5-trichlorophenyl)carbamoyl fluoride.
| Compound Name | N-(2,4,5-trichlorophenyl)carbamoyl fluoride |
|---|---|
| PubChem CID | 88834556 |
| Molecular Formula | C7H3Cl3FNO |
| Molecular Weight | 242.46 g/mol |
| Exact Mass | 240.93 |
| IUPAC Name | N-(2,4,5-trichlorophenyl)carbamoyl fluoride |
| SMILES | O=C(F)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C7H3Cl3FNO/c8-3-1-5(10)6(2-4(3)9)12-7(11)13/h1-2H,(H,12,13) |
| InChIKey | GMWAXNRKBBFCJP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|