C10H11Cl3N2O — CID 60638641
2-(methylamino)-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 60638641) has the molecular formula C10H11Cl3N2O and a molecular weight of 281.57 g/mol. Its IUPAC name is 2-(methylamino)-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | 2-(methylamino)-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 60638641 |
| Molecular Formula | C10H11Cl3N2O |
| Molecular Weight | 281.57 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 2-(methylamino)-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | CNC(C)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl3N2O/c1-5(14-2)10(16)15-9-4-7(12)6(11)3-8(9)13/h3-5,14H,1-2H3,(H,15,16) |
| InChIKey | FBSQTPKBQOCGAC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.57 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|