C13H14ClN3O2 — CID 138521251
N-(7-chloro-1-oxo-2H-isoquinolin-6-yl)-2-(methylamino)propanamide (PubChem CID 138521251) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is N-(7-chloro-1-oxo-2H-isoquinolin-6-yl)-2-(methylamino)propanamide.
| Compound Name | N-(7-chloro-1-oxo-2H-isoquinolin-6-yl)-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 138521251 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-(7-chloro-1-oxo-2H-isoquinolin-6-yl)-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)Nc1cc2cc[nH]c(=O)c2cc1Cl |
| InChI | InChI=1S/C13H14ClN3O2/c1-7(15-2)12(18)17-11-5-8-3-4-16-13(19)9(8)6-10(11)14/h3-7,15H,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | CMHOAFBXCWSUQX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |