C15H17ClN2O2 — CID 143649216
(3R)-N-(7-chloro-1-oxo-2H-isoquinolin-6-yl)-3-methylpentanamide (PubChem CID 143649216) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is (3R)-N-(7-chloro-1-oxo-2H-isoquinolin-6-yl)-3-methylpentanamide.
| Compound Name | (3R)-N-(7-chloro-1-oxo-2H-isoquinolin-6-yl)-3-methylpentanamide |
|---|---|
| PubChem CID | 143649216 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (3R)-N-(7-chloro-1-oxo-2H-isoquinolin-6-yl)-3-methylpentanamide |
| SMILES | CC[C@@H](C)CC(=O)Nc1cc2cc[nH]c(=O)c2cc1Cl |
| InChI | InChI=1S/C15H17ClN2O2/c1-3-9(2)6-14(19)18-13-7-10-4-5-17-15(20)11(10)8-12(13)16/h4-5,7-9H,3,6H2,1-2H3,(H,17,20)(H,18,19)/t9-/m1/s1 |
| InChIKey | DDWNTINMRQWLBN-SECBINFHSA-N |
| XLogP | 3.56 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |