C18H13ClN2O4 — CID 59756559
3-[(7-chloro-1-oxo-2H-isoquinolin-6-yl)amino]-3-oxo-2-phenylpropanoic acid (PubChem CID 59756559) has the molecular formula C18H13ClN2O4 and a molecular weight of 356.77 g/mol. Its IUPAC name is 3-[(7-chloro-1-oxo-2H-isoquinolin-6-yl)amino]-3-oxo-2-phenylpropanoic acid.
| Compound Name | 3-[(7-chloro-1-oxo-2H-isoquinolin-6-yl)amino]-3-oxo-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 59756559 |
| Molecular Formula | C18H13ClN2O4 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 3-[(7-chloro-1-oxo-2H-isoquinolin-6-yl)amino]-3-oxo-2-phenylpropanoic acid |
| SMILES | O=C(O)C(C(=O)Nc1cc2cc[nH]c(=O)c2cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C18H13ClN2O4/c19-13-9-12-11(6-7-20-16(12)22)8-14(13)21-17(23)15(18(24)25)10-4-2-1-3-5-10/h1-9,15H,(H,20,22)(H,21,23)(H,24,25) |
| InChIKey | YEAAZJFEKSUCPE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|