C12H15Cl3N2O — CID 103928303
(2R)-2-amino-3,3-dimethyl-N-(2,4,5-trichlorophenyl)butanamide (PubChem CID 103928303) has the molecular formula C12H15Cl3N2O and a molecular weight of 309.62 g/mol. Its IUPAC name is (2R)-2-amino-3,3-dimethyl-N-(2,4,5-trichlorophenyl)butanamide.
| Compound Name | (2R)-2-amino-3,3-dimethyl-N-(2,4,5-trichlorophenyl)butanamide |
|---|---|
| PubChem CID | 103928303 |
| Molecular Formula | C12H15Cl3N2O |
| Molecular Weight | 309.62 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | (2R)-2-amino-3,3-dimethyl-N-(2,4,5-trichlorophenyl)butanamide |
| SMILES | CC(C)(C)[C@@H](N)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl3N2O/c1-12(2,3)10(16)11(18)17-9-5-7(14)6(13)4-8(9)15/h4-5,10H,16H2,1-3H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | YYKHMXGEQUCSKM-JTQLQIEISA-N |
| XLogP | 3.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|