C13H18ClN3O2 — CID 61154980
3-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-4-chlorobenzamide (PubChem CID 61154980) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 3-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-4-chlorobenzamide.
| Compound Name | 3-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-4-chlorobenzamide |
|---|---|
| PubChem CID | 61154980 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-4-chlorobenzamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)Nc1cc(C(N)=O)ccc1Cl |
| InChI | InChI=1S/C13H18ClN3O2/c1-13(2,3)10(15)12(19)17-9-6-7(11(16)18)4-5-8(9)14/h4-6,10H,15H2,1-3H3,(H2,16,18)(H,17,19)/t10-/m1/s1 |
| InChIKey | BITUXUMNAPPJLI-SNVBAGLBSA-N |
| XLogP | 1.75 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |