C9H7Cl3N2O2 — CID 43145991
2-chloro-N-[(2,5-dichlorophenyl)carbamoyl]acetamide (PubChem CID 43145991) has the molecular formula C9H7Cl3N2O2 and a molecular weight of 281.53 g/mol. Its IUPAC name is 2-chloro-N-[(2,5-dichlorophenyl)carbamoyl]acetamide.
| Compound Name | 2-chloro-N-[(2,5-dichlorophenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 43145991 |
| Molecular Formula | C9H7Cl3N2O2 |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | 2-chloro-N-[(2,5-dichlorophenyl)carbamoyl]acetamide |
| SMILES | O=C(CCl)NC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H7Cl3N2O2/c10-4-8(15)14-9(16)13-7-3-5(11)1-2-6(7)12/h1-3H,4H2,(H2,13,14,15,16) |
| InChIKey | GFOIXGDXNXIELB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|