C8H8Cl2N4O2 — CID 75369271
1-(carbamoylamino)-3-(2,5-dichlorophenyl)urea (PubChem CID 75369271) has the molecular formula C8H8Cl2N4O2 and a molecular weight of 263.08 g/mol. Its IUPAC name is 1-(carbamoylamino)-3-(2,5-dichlorophenyl)urea.
| Compound Name | 1-(carbamoylamino)-3-(2,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 75369271 |
| Molecular Formula | C8H8Cl2N4O2 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 1-(carbamoylamino)-3-(2,5-dichlorophenyl)urea |
| SMILES | NC(=O)NNC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H8Cl2N4O2/c9-4-1-2-5(10)6(3-4)12-8(16)14-13-7(11)15/h1-3H,(H3,11,13,15)(H2,12,14,16) |
| InChIKey | MCEBRIDGWWVQAI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|