C13H7Cl2F3N2O — CID 108886224
1-(2,5-dichlorophenyl)-3-(2,3,4-trifluorophenyl)urea (PubChem CID 108886224) has the molecular formula C13H7Cl2F3N2O and a molecular weight of 335.11 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 108886224 |
| Molecular Formula | C13H7Cl2F3N2O |
| Molecular Weight | 335.11 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-(2,3,4-trifluorophenyl)urea |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H7Cl2F3N2O/c14-6-1-2-7(15)10(5-6)20-13(21)19-9-4-3-8(16)11(17)12(9)18/h1-5H,(H2,19,20,21) |
| InChIKey | XNPVOCLUQOEKQV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.11 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|