C10H7Cl2N3O2 — CID 108813934
1-(2,5-dichlorophenyl)-3-(1,2-oxazol-5-yl)urea (PubChem CID 108813934) has the molecular formula C10H7Cl2N3O2 and a molecular weight of 272.09 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-(1,2-oxazol-5-yl)urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-(1,2-oxazol-5-yl)urea |
|---|---|
| PubChem CID | 108813934 |
| Molecular Formula | C10H7Cl2N3O2 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-(1,2-oxazol-5-yl)urea |
| SMILES | O=C(Nc1ccno1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H7Cl2N3O2/c11-6-1-2-7(12)8(5-6)14-10(16)15-9-3-4-13-17-9/h1-5H,(H2,14,15,16) |
| InChIKey | GJKDPAJISSBDJM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |