C10H12Cl2N2O3 — CID 65313053
1-(2,5-dichlorophenyl)-3-(1,3-dihydroxypropan-2-yl)urea (PubChem CID 65313053) has the molecular formula C10H12Cl2N2O3 and a molecular weight of 279.12 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-(1,3-dihydroxypropan-2-yl)urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-(1,3-dihydroxypropan-2-yl)urea |
|---|---|
| PubChem CID | 65313053 |
| Molecular Formula | C10H12Cl2N2O3 |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-(1,3-dihydroxypropan-2-yl)urea |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)NC(CO)CO |
| InChI | InChI=1S/C10H12Cl2N2O3/c11-6-1-2-8(12)9(3-6)14-10(17)13-7(4-15)5-16/h1-3,7,15-16H,4-5H2,(H2,13,14,17) |
| InChIKey | ICPICWUEOOOPAC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |