C13H16Cl2N2O3 — CID 96542158
ethyl (3R)-3-[(2,5-dichlorophenyl)carbamoylamino]butanoate (PubChem CID 96542158) has the molecular formula C13H16Cl2N2O3 and a molecular weight of 319.19 g/mol. Its IUPAC name is ethyl (3R)-3-[(2,5-dichlorophenyl)carbamoylamino]butanoate.
| Compound Name | ethyl (3R)-3-[(2,5-dichlorophenyl)carbamoylamino]butanoate |
|---|---|
| PubChem CID | 96542158 |
| Molecular Formula | C13H16Cl2N2O3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | ethyl (3R)-3-[(2,5-dichlorophenyl)carbamoylamino]butanoate |
| SMILES | CCOC(=O)C[C@@H](C)NC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O3/c1-3-20-12(18)6-8(2)16-13(19)17-11-7-9(14)4-5-10(11)15/h4-5,7-8H,3,6H2,1-2H3,(H2,16,17,19)/t8-/m1/s1 |
| InChIKey | ZKYPWAOXTWMFCW-MRVPVSSYSA-N |
| XLogP | 3.46 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |