C15H21ClN2O5 — CID 3289741
ethyl 3-[(5-chloro-2,4-dimethoxyphenyl)carbamoylamino]butanoate (PubChem CID 3289741) has the molecular formula C15H21ClN2O5 and a molecular weight of 344.80 g/mol. Its IUPAC name is ethyl 3-[(5-chloro-2,4-dimethoxyphenyl)carbamoylamino]butanoate.
| Compound Name | ethyl 3-[(5-chloro-2,4-dimethoxyphenyl)carbamoylamino]butanoate |
|---|---|
| PubChem CID | 3289741 |
| Molecular Formula | C15H21ClN2O5 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | ethyl 3-[(5-chloro-2,4-dimethoxyphenyl)carbamoylamino]butanoate |
| SMILES | CCOC(=O)CC(C)NC(=O)Nc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C15H21ClN2O5/c1-5-23-14(19)6-9(2)17-15(20)18-11-7-10(16)12(21-3)8-13(11)22-4/h7-9H,5-6H2,1-4H3,(H2,17,18,20) |
| InChIKey | BERIEDXKLDWCJD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |