C12H16ClN3O3 — CID 96542162
ethyl (3R)-3-[(2-chloro-3-pyridinyl)carbamoylamino]butanoate (PubChem CID 96542162) has the molecular formula C12H16ClN3O3 and a molecular weight of 285.73 g/mol. Its IUPAC name is ethyl (3R)-3-[(2-chloro-3-pyridinyl)carbamoylamino]butanoate.
| Compound Name | ethyl (3R)-3-[(2-chloro-3-pyridinyl)carbamoylamino]butanoate |
|---|---|
| PubChem CID | 96542162 |
| Molecular Formula | C12H16ClN3O3 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | ethyl (3R)-3-[(2-chloro-3-pyridinyl)carbamoylamino]butanoate |
| SMILES | CCOC(=O)C[C@@H](C)NC(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C12H16ClN3O3/c1-3-19-10(17)7-8(2)15-12(18)16-9-5-4-6-14-11(9)13/h4-6,8H,3,7H2,1-2H3,(H2,15,16,18)/t8-/m1/s1 |
| InChIKey | LIYBBNMEYCKHOV-MRVPVSSYSA-N |
| XLogP | 2.20 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|