C12H18ClN3O2 — CID 111486854
1-(2-chloro-3-pyridinyl)-3-(3-hydroxy-4-methylpentyl)urea (PubChem CID 111486854) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is 1-(2-chloro-3-pyridinyl)-3-(3-hydroxy-4-methylpentyl)urea.
| Compound Name | 1-(2-chloro-3-pyridinyl)-3-(3-hydroxy-4-methylpentyl)urea |
|---|---|
| PubChem CID | 111486854 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-(2-chloro-3-pyridinyl)-3-(3-hydroxy-4-methylpentyl)urea |
| SMILES | CC(C)C(O)CCNC(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C12H18ClN3O2/c1-8(2)10(17)5-7-15-12(18)16-9-4-3-6-14-11(9)13/h3-4,6,8,10,17H,5,7H2,1-2H3,(H2,15,16,18) |
| InChIKey | GQRVOELVSLVRKH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|