C13H17ClN6O — CID 75457749
1-(2-chloro-3-pyridinyl)-3-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]urea (PubChem CID 75457749) has the molecular formula C13H17ClN6O and a molecular weight of 308.77 g/mol. Its IUPAC name is 1-(2-chloro-3-pyridinyl)-3-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]urea.
| Compound Name | 1-(2-chloro-3-pyridinyl)-3-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 75457749 |
| Molecular Formula | C13H17ClN6O |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1-(2-chloro-3-pyridinyl)-3-[(4-methyl-5-propan-2-yl-1,2,4-triazol-3-yl)methyl]urea |
| SMILES | CC(C)c1nnc(CNC(=O)Nc2cccnc2Cl)n1C |
| InChI | InChI=1S/C13H17ClN6O/c1-8(2)12-19-18-10(20(12)3)7-16-13(21)17-9-5-4-6-15-11(9)14/h4-6,8H,7H2,1-3H3,(H2,16,17,21) |
| InChIKey | CZHXJRFYHYVJCT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|