C15H19ClN4O2 — CID 71989228
1-(2-chloro-3-pyridinyl)-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]urea (PubChem CID 71989228) has the molecular formula C15H19ClN4O2 and a molecular weight of 322.80 g/mol. Its IUPAC name is 1-(2-chloro-3-pyridinyl)-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]urea.
| Compound Name | 1-(2-chloro-3-pyridinyl)-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 71989228 |
| Molecular Formula | C15H19ClN4O2 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-(2-chloro-3-pyridinyl)-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]urea |
| SMILES | CCC(CC)c1cc(CNC(=O)Nc2cccnc2Cl)on1 |
| InChI | InChI=1S/C15H19ClN4O2/c1-3-10(4-2)13-8-11(22-20-13)9-18-15(21)19-12-6-5-7-17-14(12)16/h5-8,10H,3-4,9H2,1-2H3,(H2,18,19,21) |
| InChIKey | FPNLZONAQMFMGB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|