C10H11ClN6O — CID 97158665
1-(2-chloro-3-pyridinyl)-3-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]urea (PubChem CID 97158665) has the molecular formula C10H11ClN6O and a molecular weight of 266.69 g/mol. Its IUPAC name is 1-(2-chloro-3-pyridinyl)-3-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]urea.
| Compound Name | 1-(2-chloro-3-pyridinyl)-3-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 97158665 |
| Molecular Formula | C10H11ClN6O |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-(2-chloro-3-pyridinyl)-3-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]urea |
| SMILES | C[C@H](NC(=O)Nc1cccnc1Cl)c1ncn[nH]1 |
| InChI | InChI=1S/C10H11ClN6O/c1-6(9-13-5-14-17-9)15-10(18)16-7-3-2-4-12-8(7)11/h2-6H,1H3,(H,13,14,17)(H2,15,16,18)/t6-/m0/s1 |
| InChIKey | IMPQACBIHYRXHQ-LURJTMIESA-N |
| XLogP | 1.74 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|