C16H18N6O — CID 124728310
1-(2-ethylquinolin-4-yl)-3-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]urea (PubChem CID 124728310) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 1-(2-ethylquinolin-4-yl)-3-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]urea.
| Compound Name | 1-(2-ethylquinolin-4-yl)-3-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 124728310 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-(2-ethylquinolin-4-yl)-3-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]urea |
| SMILES | CCc1cc(NC(=O)N[C@@H](C)c2ncn[nH]2)c2ccccc2n1 |
| InChI | InChI=1S/C16H18N6O/c1-3-11-8-14(12-6-4-5-7-13(12)20-11)21-16(23)19-10(2)15-17-9-18-22-15/h4-10H,3H2,1-2H3,(H,17,18,22)(H2,19,20,21,23)/t10-/m0/s1 |
| InChIKey | DHSAJBTXYSOMBX-JTQLQIEISA-N |
| XLogP | 2.80 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |