C14H13N5O — CID 103725802
N-[1-(1H-1,2,4-triazol-5-yl)ethyl]quinoline-4-carboxamide (PubChem CID 103725802) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is N-[1-(1H-1,2,4-triazol-5-yl)ethyl]quinoline-4-carboxamide.
| Compound Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 103725802 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]quinoline-4-carboxamide |
| SMILES | CC(NC(=O)c1ccnc2ccccc12)c1ncn[nH]1 |
| InChI | InChI=1S/C14H13N5O/c1-9(13-16-8-17-19-13)18-14(20)11-6-7-15-12-5-3-2-4-10(11)12/h2-9H,1H3,(H,18,20)(H,16,17,19) |
| InChIKey | IGYFCXQWIQQDGU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |