C12H11F3N4O — CID 103716638
N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 103716638) has the molecular formula C12H11F3N4O and a molecular weight of 284.24 g/mol. Its IUPAC name is N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 103716638 |
| Molecular Formula | C12H11F3N4O |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | CC(NC(=O)c1ccccc1C(F)(F)F)c1ncn[nH]1 |
| InChI | InChI=1S/C12H11F3N4O/c1-7(10-16-6-17-19-10)18-11(20)8-4-2-3-5-9(8)12(13,14)15/h2-7H,1H3,(H,18,20)(H,16,17,19) |
| InChIKey | OOLBOUJCWJWDNR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |