C11H10BrFN4O — CID 106281965
2-bromo-3-fluoro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide (PubChem CID 106281965) has the molecular formula C11H10BrFN4O and a molecular weight of 313.13 g/mol. Its IUPAC name is 2-bromo-3-fluoro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide.
| Compound Name | 2-bromo-3-fluoro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 106281965 |
| Molecular Formula | C11H10BrFN4O |
| Molecular Weight | 313.13 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2-bromo-3-fluoro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1cccc(F)c1Br)c1ncn[nH]1 |
| InChI | InChI=1S/C11H10BrFN4O/c1-6(10-14-5-15-17-10)16-11(18)7-3-2-4-8(13)9(7)12/h2-6H,1H3,(H,16,18)(H,14,15,17) |
| InChIKey | UWCBDPKJWSSDGN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.13 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |