C11H12BrN5O — CID 104878265
2-amino-4-bromo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide (PubChem CID 104878265) has the molecular formula C11H12BrN5O and a molecular weight of 310.16 g/mol. Its IUPAC name is 2-amino-4-bromo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide.
| Compound Name | 2-amino-4-bromo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 104878265 |
| Molecular Formula | C11H12BrN5O |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-amino-4-bromo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(Br)cc1N)c1ncn[nH]1 |
| InChI | InChI=1S/C11H12BrN5O/c1-6(10-14-5-15-17-10)16-11(18)8-3-2-7(12)4-9(8)13/h2-6H,13H2,1H3,(H,16,18)(H,14,15,17) |
| InChIKey | CGZRBYOSWVCHJG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|