C12H14ClNO5 — CID 3311966
ethyl 2-(4-chloro-2,5-dimethoxyanilino)-2-oxoacetate (PubChem CID 3311966) has the molecular formula C12H14ClNO5 and a molecular weight of 287.70 g/mol. Its IUPAC name is ethyl 2-(4-chloro-2,5-dimethoxyanilino)-2-oxoacetate.
| Compound Name | ethyl 2-(4-chloro-2,5-dimethoxyanilino)-2-oxoacetate |
|---|---|
| PubChem CID | 3311966 |
| Molecular Formula | C12H14ClNO5 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | ethyl 2-(4-chloro-2,5-dimethoxyanilino)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C12H14ClNO5/c1-4-19-12(16)11(15)14-8-6-9(17-2)7(13)5-10(8)18-3/h5-6H,4H2,1-3H3,(H,14,15) |
| InChIKey | MHAMICMNFBRWGK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|